EN450 is a cysteine-reactive covalent molecular gel reducing agent targeting NF-κB. EN450 interacts with allosteric C111 in the E2 ubiquitin ligase UBE2D. EN450 induces the formation of ternary complexes between UBE2D and NFKB1. EN450 exerts anti-proliferation effects through Cullin E3 ligase and proteasome-dependent mechanisms.

 

Brand: BCM

 

Target: NF-κB; E1/E2/E3 Enzyme

 

Signaling Pathways: NF-κB; Metabolic Enzyme/Protease

 

pKa: 12.16±0.70(Predicted)

 

Isomeric SMILES: CN(C)S(=O)(=O)C1=CC(=C(C=C1)Cl)NC(=O)C=C  

 

InChIKey: OXFXDOLAQBMOPH-UHFFFAOYSA-N  

 

InChI: InChI=1S/C11H13ClN2O3S/c1-4-11(15)13-10-7-8(5-6-9(10)12)18(16,17)14(2)3/h4-7H,1H2,2-3H3,(H,13,15) 

 

Attribute
[Chem Name]	N-[2-chloro-5-(dimethylsulfamoyl)phenyl]prop-2-enamide
[Synonym]	EN450; EN-450; EN 450; starbld0003560; GTPL12636
[CAS No.]	793719-01-4
[Formula]	C11H13ClN2O3S
[Molecular]	288.75
[Form]	Solid
[Storage]	Sealed in dry. Stored at -20°C

Goods Tag